5-({[5-benzyl-4-(4-chlorophenyl)-4H-1,2,4-triazol-3-yl]sulfanyl}methyl)-3-(thiophen-2-yl)-1,2,4-oxadiazole
Chemical Structure Depiction of
5-({[5-benzyl-4-(4-chlorophenyl)-4H-1,2,4-triazol-3-yl]sulfanyl}methyl)-3-(thiophen-2-yl)-1,2,4-oxadiazole
5-({[5-benzyl-4-(4-chlorophenyl)-4H-1,2,4-triazol-3-yl]sulfanyl}methyl)-3-(thiophen-2-yl)-1,2,4-oxadiazole
Compound characteristics
| Compound ID: | D065-0108 |
| Compound Name: | 5-({[5-benzyl-4-(4-chlorophenyl)-4H-1,2,4-triazol-3-yl]sulfanyl}methyl)-3-(thiophen-2-yl)-1,2,4-oxadiazole |
| Molecular Weight: | 465.98 |
| Molecular Formula: | C22 H16 Cl N5 O S2 |
| Smiles: | C(c1ccccc1)c1nnc(n1c1ccc(cc1)[Cl])SCc1nc(c2cccs2)no1 |
| Stereo: | ACHIRAL |
| logP: | 5.8253 |
| logD: | 5.8253 |
| logSw: | -6.16 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 58.05 |
| InChI Key: | AKCRCENMTMMBOA-UHFFFAOYSA-N |