ethyl 4-[(3,4-dihydro-1H-2-benzopyran-1-carbonyl)amino]benzoate
Chemical Structure Depiction of
ethyl 4-[(3,4-dihydro-1H-2-benzopyran-1-carbonyl)amino]benzoate
ethyl 4-[(3,4-dihydro-1H-2-benzopyran-1-carbonyl)amino]benzoate
Compound characteristics
| Compound ID: | D068-0019 |
| Compound Name: | ethyl 4-[(3,4-dihydro-1H-2-benzopyran-1-carbonyl)amino]benzoate |
| Molecular Weight: | 325.36 |
| Molecular Formula: | C19 H19 N O4 |
| Smiles: | CCOC(c1ccc(cc1)NC(C1c2ccccc2CCO1)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.5444 |
| logD: | 3.5378 |
| logSw: | -3.4335 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 52.473 |
| InChI Key: | GVDNLHBNSGDSAB-QGZVFWFLSA-N |