N-(4-chlorophenyl)-3-[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]propanamide
Chemical Structure Depiction of
N-(4-chlorophenyl)-3-[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]propanamide
N-(4-chlorophenyl)-3-[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]propanamide
Compound characteristics
| Compound ID: | D069-0243 |
| Compound Name: | N-(4-chlorophenyl)-3-[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]propanamide |
| Molecular Weight: | 387.82 |
| Molecular Formula: | C19 H18 Cl N3 O4 |
| Smiles: | COc1ccc(cc1OC)c1nc(CCC(Nc2ccc(cc2)[Cl])=O)on1 |
| Stereo: | ACHIRAL |
| logP: | 3.9205 |
| logD: | 3.9203 |
| logSw: | -4.5514 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 69.72 |
| InChI Key: | TXGMJMTYVTYCSF-UHFFFAOYSA-N |