3-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-(2,5-dimethylphenyl)propanamide
Chemical Structure Depiction of
3-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-(2,5-dimethylphenyl)propanamide
3-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-(2,5-dimethylphenyl)propanamide
Compound characteristics
| Compound ID: | D069-0357 |
| Compound Name: | 3-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-(2,5-dimethylphenyl)propanamide |
| Molecular Weight: | 355.82 |
| Molecular Formula: | C19 H18 Cl N3 O2 |
| Smiles: | Cc1ccc(C)c(c1)NC(CCc1nc(c2ccc(cc2)[Cl])no1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.3393 |
| logD: | 4.3393 |
| logSw: | -4.5134 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 53.761 |
| InChI Key: | MBRIECLSPOQFBS-UHFFFAOYSA-N |