4-(4-fluorobenzene-1-sulfonyl)-N-methyl-2-(3-methylphenyl)-1,3-oxazol-5-amine
Chemical Structure Depiction of
4-(4-fluorobenzene-1-sulfonyl)-N-methyl-2-(3-methylphenyl)-1,3-oxazol-5-amine
4-(4-fluorobenzene-1-sulfonyl)-N-methyl-2-(3-methylphenyl)-1,3-oxazol-5-amine
Compound characteristics
| Compound ID: | D072-0018 |
| Compound Name: | 4-(4-fluorobenzene-1-sulfonyl)-N-methyl-2-(3-methylphenyl)-1,3-oxazol-5-amine |
| Molecular Weight: | 346.38 |
| Molecular Formula: | C17 H15 F N2 O3 S |
| Smiles: | Cc1cccc(c1)c1nc(c(NC)o1)S(c1ccc(cc1)F)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.5091 |
| logD: | 3.5091 |
| logSw: | -3.8355 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 58.424 |
| InChI Key: | PKKBAPXAUZNDCE-UHFFFAOYSA-N |