4-(4-chlorobenzene-1-sulfonyl)-2-(4-methylphenyl)-N-[(pyridin-3-yl)methyl]-1,3-oxazol-5-amine
Chemical Structure Depiction of
4-(4-chlorobenzene-1-sulfonyl)-2-(4-methylphenyl)-N-[(pyridin-3-yl)methyl]-1,3-oxazol-5-amine
4-(4-chlorobenzene-1-sulfonyl)-2-(4-methylphenyl)-N-[(pyridin-3-yl)methyl]-1,3-oxazol-5-amine
Compound characteristics
| Compound ID: | D072-0569 |
| Compound Name: | 4-(4-chlorobenzene-1-sulfonyl)-2-(4-methylphenyl)-N-[(pyridin-3-yl)methyl]-1,3-oxazol-5-amine |
| Molecular Weight: | 439.92 |
| Molecular Formula: | C22 H18 Cl N3 O3 S |
| Smiles: | Cc1ccc(cc1)c1nc(c(NCc2cccnc2)o1)S(c1ccc(cc1)[Cl])(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.4291 |
| logD: | 4.4145 |
| logSw: | -4.68 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 67.52 |
| InChI Key: | DXDGEBGEEDSLAE-UHFFFAOYSA-N |