1-[4-(benzenesulfonyl)-2-phenyl-1,3-oxazol-5-yl]-4-phenylpiperazine
Chemical Structure Depiction of
1-[4-(benzenesulfonyl)-2-phenyl-1,3-oxazol-5-yl]-4-phenylpiperazine
1-[4-(benzenesulfonyl)-2-phenyl-1,3-oxazol-5-yl]-4-phenylpiperazine
Compound characteristics
| Compound ID: | D072-0714 |
| Compound Name: | 1-[4-(benzenesulfonyl)-2-phenyl-1,3-oxazol-5-yl]-4-phenylpiperazine |
| Molecular Weight: | 445.54 |
| Molecular Formula: | C25 H23 N3 O3 S |
| Smiles: | [H]c1ccc(cc1)S(c1c(N2CCN(CC2)c2ccccc2)oc(c2ccccc2)n1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.9753 |
| logD: | 4.9752 |
| logSw: | -4.9101 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 54.739 |
| InChI Key: | YXUSLNGFPNPQGB-UHFFFAOYSA-N |