4-(benzenesulfonyl)-2-(2-fluorophenyl)-N-[(oxolan-2-yl)methyl]-1,3-oxazol-5-amine
Chemical Structure Depiction of
4-(benzenesulfonyl)-2-(2-fluorophenyl)-N-[(oxolan-2-yl)methyl]-1,3-oxazol-5-amine
4-(benzenesulfonyl)-2-(2-fluorophenyl)-N-[(oxolan-2-yl)methyl]-1,3-oxazol-5-amine
Compound characteristics
| Compound ID: | D072-1615 |
| Compound Name: | 4-(benzenesulfonyl)-2-(2-fluorophenyl)-N-[(oxolan-2-yl)methyl]-1,3-oxazol-5-amine |
| Molecular Weight: | 402.44 |
| Molecular Formula: | C20 H19 F N2 O4 S |
| Smiles: | C1CC(CNc2c(nc(c3ccccc3F)o2)S(c2ccccc2)(=O)=O)OC1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.1892 |
| logD: | 3.1892 |
| logSw: | -3.667 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 66.656 |
| InChI Key: | USUSEURJAFBJFC-CQSZACIVSA-N |