N-(1,1-dioxo-1lambda~6~-thiolan-3-yl)-2-fluoro-N-[(3-methoxyphenyl)methyl]benzamide
Chemical Structure Depiction of
N-(1,1-dioxo-1lambda~6~-thiolan-3-yl)-2-fluoro-N-[(3-methoxyphenyl)methyl]benzamide
N-(1,1-dioxo-1lambda~6~-thiolan-3-yl)-2-fluoro-N-[(3-methoxyphenyl)methyl]benzamide
Compound characteristics
| Compound ID: | D076-0074 |
| Compound Name: | N-(1,1-dioxo-1lambda~6~-thiolan-3-yl)-2-fluoro-N-[(3-methoxyphenyl)methyl]benzamide |
| Molecular Weight: | 377.43 |
| Molecular Formula: | C19 H20 F N O4 S |
| Smiles: | COc1cccc(CN(C2CCS(C2)(=O)=O)C(c2ccccc2F)=O)c1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.0634 |
| logD: | 2.0634 |
| logSw: | -2.9053 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 51.403 |
| InChI Key: | FFYKJVXTKOUUSX-OAHLLOKOSA-N |