N-(1,1-dioxo-1lambda~6~-thiolan-3-yl)-N-[(3-methoxyphenyl)methyl]-3-methyl-1-benzofuran-2-carboxamide
					Chemical Structure Depiction of
N-(1,1-dioxo-1lambda~6~-thiolan-3-yl)-N-[(3-methoxyphenyl)methyl]-3-methyl-1-benzofuran-2-carboxamide
			N-(1,1-dioxo-1lambda~6~-thiolan-3-yl)-N-[(3-methoxyphenyl)methyl]-3-methyl-1-benzofuran-2-carboxamide
Compound characteristics
| Compound ID: | D076-0096 | 
| Compound Name: | N-(1,1-dioxo-1lambda~6~-thiolan-3-yl)-N-[(3-methoxyphenyl)methyl]-3-methyl-1-benzofuran-2-carboxamide | 
| Molecular Weight: | 413.49 | 
| Molecular Formula: | C22 H23 N O5 S | 
| Smiles: | Cc1c2ccccc2oc1C(N(Cc1cccc(c1)OC)C1CCS(C1)(=O)=O)=O | 
| Stereo: | RACEMIC MIXTURE | 
| logP: | 3.1892 | 
| logD: | 3.1892 | 
| logSw: | -3.445 | 
| Hydrogen bond acceptors count: | 8 | 
| Polar surface area: | 59.929 | 
| InChI Key: | KQWHNULUYHWRIK-QGZVFWFLSA-N | 
 
				 
				