2-chloro-N-(1,1-dioxo-1lambda~6~-thiolan-3-yl)-N-[(3-fluorophenyl)methyl]benzamide
Chemical Structure Depiction of
2-chloro-N-(1,1-dioxo-1lambda~6~-thiolan-3-yl)-N-[(3-fluorophenyl)methyl]benzamide
2-chloro-N-(1,1-dioxo-1lambda~6~-thiolan-3-yl)-N-[(3-fluorophenyl)methyl]benzamide
Compound characteristics
| Compound ID: | D076-0122 |
| Compound Name: | 2-chloro-N-(1,1-dioxo-1lambda~6~-thiolan-3-yl)-N-[(3-fluorophenyl)methyl]benzamide |
| Molecular Weight: | 381.85 |
| Molecular Formula: | C18 H17 Cl F N O3 S |
| Smiles: | C1CS(CC1N(Cc1cccc(c1)F)C(c1ccccc1[Cl])=O)(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.4085 |
| logD: | 2.4085 |
| logSw: | -3.4178 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 43.86 |
| InChI Key: | SJANJBZDIJAGDX-HNNXBMFYSA-N |