3,5-dichloro-N-(1,1-dioxo-1lambda~6~-thiolan-3-yl)-N-[(3-fluorophenyl)methyl]-4-methoxybenzamide
Chemical Structure Depiction of
3,5-dichloro-N-(1,1-dioxo-1lambda~6~-thiolan-3-yl)-N-[(3-fluorophenyl)methyl]-4-methoxybenzamide
3,5-dichloro-N-(1,1-dioxo-1lambda~6~-thiolan-3-yl)-N-[(3-fluorophenyl)methyl]-4-methoxybenzamide
Compound characteristics
| Compound ID: | D076-0296 |
| Compound Name: | 3,5-dichloro-N-(1,1-dioxo-1lambda~6~-thiolan-3-yl)-N-[(3-fluorophenyl)methyl]-4-methoxybenzamide |
| Molecular Weight: | 446.32 |
| Molecular Formula: | C19 H18 Cl2 F N O4 S |
| Smiles: | COc1c(cc(cc1[Cl])C(N(Cc1cccc(c1)F)C1CCS(C1)(=O)=O)=O)[Cl] |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.3457 |
| logD: | 3.3457 |
| logSw: | -3.7423 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 51.577 |
| InChI Key: | VSGYWYJWWCYDQU-HNNXBMFYSA-N |