5-(4-chlorophenyl)-1,3-dimethyl-6-pentyl-1H-pyrrolo[3,4-d]pyrimidine-2,4(3H,6H)-dione
Chemical Structure Depiction of
5-(4-chlorophenyl)-1,3-dimethyl-6-pentyl-1H-pyrrolo[3,4-d]pyrimidine-2,4(3H,6H)-dione
5-(4-chlorophenyl)-1,3-dimethyl-6-pentyl-1H-pyrrolo[3,4-d]pyrimidine-2,4(3H,6H)-dione
Compound characteristics
| Compound ID: | D077-0209 |
| Compound Name: | 5-(4-chlorophenyl)-1,3-dimethyl-6-pentyl-1H-pyrrolo[3,4-d]pyrimidine-2,4(3H,6H)-dione |
| Molecular Weight: | 359.85 |
| Molecular Formula: | C19 H22 Cl N3 O2 |
| Smiles: | CCCCCn1cc2c(C(N(C)C(N2C)=O)=O)c1c1ccc(cc1)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 4.4693 |
| logD: | 4.4693 |
| logSw: | -4.8805 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 32.578 |
| InChI Key: | IAOBQLNXCRCCDB-UHFFFAOYSA-N |