5,6-bis(4-chlorophenyl)-1,3-dimethyl-1H-pyrrolo[3,4-d]pyrimidine-2,4(3H,6H)-dione
Chemical Structure Depiction of
5,6-bis(4-chlorophenyl)-1,3-dimethyl-1H-pyrrolo[3,4-d]pyrimidine-2,4(3H,6H)-dione
5,6-bis(4-chlorophenyl)-1,3-dimethyl-1H-pyrrolo[3,4-d]pyrimidine-2,4(3H,6H)-dione
Compound characteristics
| Compound ID: | D077-0211 |
| Compound Name: | 5,6-bis(4-chlorophenyl)-1,3-dimethyl-1H-pyrrolo[3,4-d]pyrimidine-2,4(3H,6H)-dione |
| Molecular Weight: | 400.26 |
| Molecular Formula: | C20 H15 Cl2 N3 O2 |
| Smiles: | CN1C(c2c(cn(c3ccc(cc3)[Cl])c2c2ccc(cc2)[Cl])N(C)C1=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.7186 |
| logD: | 4.7186 |
| logSw: | -5.2374 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 32.787 |
| InChI Key: | KFUKPNDSYQHLHB-UHFFFAOYSA-N |