N-{2-[1-(1-phenylethyl)-1H-benzimidazol-2-yl]ethyl}furan-2-carboxamide
Chemical Structure Depiction of
N-{2-[1-(1-phenylethyl)-1H-benzimidazol-2-yl]ethyl}furan-2-carboxamide
N-{2-[1-(1-phenylethyl)-1H-benzimidazol-2-yl]ethyl}furan-2-carboxamide
Compound characteristics
| Compound ID: | D078-0021 |
| Compound Name: | N-{2-[1-(1-phenylethyl)-1H-benzimidazol-2-yl]ethyl}furan-2-carboxamide |
| Molecular Weight: | 359.43 |
| Molecular Formula: | C22 H21 N3 O2 |
| Smiles: | CC(c1ccccc1)n1c2ccccc2nc1CCNC(c1ccco1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.6427 |
| logD: | 3.6426 |
| logSw: | -3.85 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 44.672 |
| InChI Key: | LIYHADHNBZCNMC-INIZCTEOSA-N |