1-(4-bromophenyl)-6,7-diethoxy-2-(4-methoxyphenyl)-1,4-dihydroisoquinolin-3(2H)-one
Chemical Structure Depiction of
1-(4-bromophenyl)-6,7-diethoxy-2-(4-methoxyphenyl)-1,4-dihydroisoquinolin-3(2H)-one
1-(4-bromophenyl)-6,7-diethoxy-2-(4-methoxyphenyl)-1,4-dihydroisoquinolin-3(2H)-one
Compound characteristics
| Compound ID: | D081-0028 |
| Compound Name: | 1-(4-bromophenyl)-6,7-diethoxy-2-(4-methoxyphenyl)-1,4-dihydroisoquinolin-3(2H)-one |
| Molecular Weight: | 496.4 |
| Molecular Formula: | C26 H26 Br N O4 |
| Smiles: | CCOc1cc2CC(N(C(c3ccc(cc3)[Br])c2cc1OCC)c1ccc(cc1)OC)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.089 |
| logD: | 5.089 |
| logSw: | -4.9674 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 37.282 |
| InChI Key: | DJXMYTVZKXCYTK-SANMLTNESA-N |