2-(3,4-dimethylanilino)-6-propylpyrimidin-4(3H)-one
Chemical Structure Depiction of
2-(3,4-dimethylanilino)-6-propylpyrimidin-4(3H)-one
2-(3,4-dimethylanilino)-6-propylpyrimidin-4(3H)-one
Compound characteristics
| Compound ID: | D083-0015 |
| Compound Name: | 2-(3,4-dimethylanilino)-6-propylpyrimidin-4(3H)-one |
| Molecular Weight: | 257.33 |
| Molecular Formula: | C15 H19 N3 O |
| Smiles: | CCCC1=CC(NC(Nc2ccc(C)c(C)c2)=N1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.7032 |
| logD: | 3.6965 |
| logSw: | -3.7706 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 44.963 |
| InChI Key: | ALUPKFZPAYCGHR-UHFFFAOYSA-N |