5-amino-4-(1H-benzimidazol-2-yl)-1-(2-methoxyphenyl)-1,2-dihydro-3H-pyrrol-3-one
Chemical Structure Depiction of
5-amino-4-(1H-benzimidazol-2-yl)-1-(2-methoxyphenyl)-1,2-dihydro-3H-pyrrol-3-one
5-amino-4-(1H-benzimidazol-2-yl)-1-(2-methoxyphenyl)-1,2-dihydro-3H-pyrrol-3-one
Compound characteristics
| Compound ID: | D086-0047 |
| Compound Name: | 5-amino-4-(1H-benzimidazol-2-yl)-1-(2-methoxyphenyl)-1,2-dihydro-3H-pyrrol-3-one |
| Molecular Weight: | 320.35 |
| Molecular Formula: | C18 H16 N4 O2 |
| Smiles: | COc1ccccc1N1CC(C(=C1N)c1nc2ccccc2[nH]1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.2322 |
| logD: | 2.2322 |
| logSw: | -2.6135 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 63.32 |
| InChI Key: | CROFOOOIISPNIU-UHFFFAOYSA-N |