N,N-diethyl-1,1-dioxo-1lambda~6~-thiolane-3-sulfonamide
Chemical Structure Depiction of
N,N-diethyl-1,1-dioxo-1lambda~6~-thiolane-3-sulfonamide
N,N-diethyl-1,1-dioxo-1lambda~6~-thiolane-3-sulfonamide
Compound characteristics
| Compound ID: | D087-0018 |
| Compound Name: | N,N-diethyl-1,1-dioxo-1lambda~6~-thiolane-3-sulfonamide |
| Molecular Weight: | 255.35 |
| Molecular Formula: | C8 H17 N O4 S2 |
| Smiles: | CCN(CC)S(C1CCS(C1)(=O)=O)(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | -0.2589 |
| logD: | -0.2589 |
| logSw: | -0.4337 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 59.964 |
| InChI Key: | JCVYBNNWFCKBBI-MRVPVSSYSA-N |