3-(4-phenylpiperazine-1-sulfonyl)-1lambda~6~-thiolane-1,1-dione
Chemical Structure Depiction of
3-(4-phenylpiperazine-1-sulfonyl)-1lambda~6~-thiolane-1,1-dione
3-(4-phenylpiperazine-1-sulfonyl)-1lambda~6~-thiolane-1,1-dione
Compound characteristics
| Compound ID: | D087-0486 |
| Compound Name: | 3-(4-phenylpiperazine-1-sulfonyl)-1lambda~6~-thiolane-1,1-dione |
| Molecular Weight: | 344.45 |
| Molecular Formula: | C14 H20 N2 O4 S2 |
| Smiles: | C1CS(CC1S(N1CCN(CC1)c1ccccc1)(=O)=O)(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 0.6307 |
| logD: | 0.6307 |
| logSw: | -1.8373 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 63.839 |
| InChI Key: | DRHMOHLLFYWVGC-CQSZACIVSA-N |