2-(1H-benzotriazol-1-yl)-N-benzyl-N-[2-(benzylamino)-1-(3,4-dimethoxyphenyl)-2-oxoethyl]acetamide
Chemical Structure Depiction of
2-(1H-benzotriazol-1-yl)-N-benzyl-N-[2-(benzylamino)-1-(3,4-dimethoxyphenyl)-2-oxoethyl]acetamide
2-(1H-benzotriazol-1-yl)-N-benzyl-N-[2-(benzylamino)-1-(3,4-dimethoxyphenyl)-2-oxoethyl]acetamide
Compound characteristics
| Compound ID: | D092-0168 |
| Compound Name: | 2-(1H-benzotriazol-1-yl)-N-benzyl-N-[2-(benzylamino)-1-(3,4-dimethoxyphenyl)-2-oxoethyl]acetamide |
| Molecular Weight: | 549.63 |
| Molecular Formula: | C32 H31 N5 O4 |
| Smiles: | COc1ccc(cc1OC)C(C(NCc1ccccc1)=O)N(Cc1ccccc1)C(Cn1c2ccccc2nn1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.5623 |
| logD: | 3.5623 |
| logSw: | -3.6998 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 80.007 |
| InChI Key: | OWYQTCMBUOLPLA-WJOKGBTCSA-N |