N-cyclohexyl-3,4-dimethoxy-N-{[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl}benzamide
Chemical Structure Depiction of
N-cyclohexyl-3,4-dimethoxy-N-{[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl}benzamide
N-cyclohexyl-3,4-dimethoxy-N-{[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl}benzamide
Compound characteristics
| Compound ID: | D101-0002 |
| Compound Name: | N-cyclohexyl-3,4-dimethoxy-N-{[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl}benzamide |
| Molecular Weight: | 451.52 |
| Molecular Formula: | C25 H29 N3 O5 |
| Smiles: | COc1ccc(cc1)c1nc(CN(C2CCCCC2)C(c2ccc(c(c2)OC)OC)=O)on1 |
| Stereo: | ACHIRAL |
| logP: | 4.8624 |
| logD: | 4.8624 |
| logSw: | -4.6909 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 69.57 |
| InChI Key: | FCMHMZSBSLQYRM-UHFFFAOYSA-N |