N-{[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl}benzamide
Chemical Structure Depiction of
N-{[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl}benzamide
N-{[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl}benzamide
Compound characteristics
| Compound ID: | D101-0127 |
| Compound Name: | N-{[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl}benzamide |
| Molecular Weight: | 309.32 |
| Molecular Formula: | C17 H15 N3 O3 |
| Smiles: | COc1ccc(cc1)c1nc(CNC(c2ccccc2)=O)on1 |
| Stereo: | ACHIRAL |
| logP: | 3.2603 |
| logD: | 3.2603 |
| logSw: | -3.4652 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 63.539 |
| InChI Key: | DGCXIMDHMNHWEC-UHFFFAOYSA-N |