2-methyl-N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]benzamide
Chemical Structure Depiction of
2-methyl-N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]benzamide
2-methyl-N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]benzamide
Compound characteristics
| Compound ID: | D101-0128 |
| Compound Name: | 2-methyl-N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]benzamide |
| Molecular Weight: | 293.32 |
| Molecular Formula: | C17 H15 N3 O2 |
| Smiles: | Cc1ccccc1C(NCc1nc(c2ccccc2)no1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.7946 |
| logD: | 3.7946 |
| logSw: | -3.9994 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 55.995 |
| InChI Key: | HEIPMHRAJDQVFW-UHFFFAOYSA-N |