2-chloro-N-{[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl}benzamide
Chemical Structure Depiction of
2-chloro-N-{[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl}benzamide
2-chloro-N-{[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl}benzamide
Compound characteristics
| Compound ID: | D101-0164 |
| Compound Name: | 2-chloro-N-{[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl}benzamide |
| Molecular Weight: | 327.77 |
| Molecular Formula: | C17 H14 Cl N3 O2 |
| Smiles: | Cc1cccc(c1)c1nc(CNC(c2ccccc2[Cl])=O)on1 |
| Stereo: | ACHIRAL |
| logP: | 4.5052 |
| logD: | 4.505 |
| logSw: | -4.5476 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 55.995 |
| InChI Key: | YVEBJAPDOCFUIS-UHFFFAOYSA-N |