4-fluoro-N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]benzene-1-sulfonamide
Chemical Structure Depiction of
4-fluoro-N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]benzene-1-sulfonamide
4-fluoro-N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]benzene-1-sulfonamide
Compound characteristics
| Compound ID: | D101-0405 |
| Compound Name: | 4-fluoro-N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]benzene-1-sulfonamide |
| Molecular Weight: | 333.34 |
| Molecular Formula: | C15 H12 F N3 O3 S |
| Smiles: | C(c1nc(c2ccccc2)no1)NS(c1ccc(cc1)F)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.3548 |
| logD: | 3.2828 |
| logSw: | -3.6671 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 73.34 |
| InChI Key: | URCAXLMIXBPILD-UHFFFAOYSA-N |