N-{[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl}-2,4-dimethylbenzamide
Chemical Structure Depiction of
N-{[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl}-2,4-dimethylbenzamide
N-{[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl}-2,4-dimethylbenzamide
Compound characteristics
| Compound ID: | D101-0535 |
| Compound Name: | N-{[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl}-2,4-dimethylbenzamide |
| Molecular Weight: | 337.38 |
| Molecular Formula: | C19 H19 N3 O3 |
| Smiles: | Cc1ccc(C(NCc2nc(c3ccc(cc3)OC)no2)=O)c(C)c1 |
| Stereo: | ACHIRAL |
| logP: | 4.5162 |
| logD: | 4.5161 |
| logSw: | -4.3066 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 63.539 |
| InChI Key: | JUSMFVPPXKIJQE-UHFFFAOYSA-N |