N-(2-fluorophenyl)-6-methyl-4-oxo-4H-1-benzopyran-2-carboxamide
Chemical Structure Depiction of
N-(2-fluorophenyl)-6-methyl-4-oxo-4H-1-benzopyran-2-carboxamide
N-(2-fluorophenyl)-6-methyl-4-oxo-4H-1-benzopyran-2-carboxamide
Compound characteristics
| Compound ID: | D103-0023 |
| Compound Name: | N-(2-fluorophenyl)-6-methyl-4-oxo-4H-1-benzopyran-2-carboxamide |
| Molecular Weight: | 297.28 |
| Molecular Formula: | C17 H12 F N O3 |
| Smiles: | [H]N(C(C1=CC(c2cc(C)ccc2O1)=O)=O)c1ccccc1F |
| Stereo: | ACHIRAL |
| logP: | 3.5632 |
| logD: | 3.5522 |
| logSw: | -3.8022 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 44.45 |
| InChI Key: | HZYZPOBXQCGZBU-UHFFFAOYSA-N |