N-(2-ethoxyphenyl)-6-methyl-4-oxo-4H-1-benzopyran-2-carboxamide
Chemical Structure Depiction of
N-(2-ethoxyphenyl)-6-methyl-4-oxo-4H-1-benzopyran-2-carboxamide
N-(2-ethoxyphenyl)-6-methyl-4-oxo-4H-1-benzopyran-2-carboxamide
Compound characteristics
| Compound ID: | D103-0040 |
| Compound Name: | N-(2-ethoxyphenyl)-6-methyl-4-oxo-4H-1-benzopyran-2-carboxamide |
| Molecular Weight: | 323.35 |
| Molecular Formula: | C19 H17 N O4 |
| Smiles: | [H]N(C(C1=CC(c2cc(C)ccc2O1)=O)=O)c1ccccc1OCC |
| Stereo: | ACHIRAL |
| logP: | 3.9577 |
| logD: | 3.9538 |
| logSw: | -3.9563 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 51.66 |
| InChI Key: | HCDYCSOFDOQRAJ-UHFFFAOYSA-N |