N-(2,5-dimethylphenyl)-7-methyl-4-oxo-4H-1-benzopyran-2-carboxamide
Chemical Structure Depiction of
N-(2,5-dimethylphenyl)-7-methyl-4-oxo-4H-1-benzopyran-2-carboxamide
N-(2,5-dimethylphenyl)-7-methyl-4-oxo-4H-1-benzopyran-2-carboxamide
Compound characteristics
| Compound ID: | D103-0101 |
| Compound Name: | N-(2,5-dimethylphenyl)-7-methyl-4-oxo-4H-1-benzopyran-2-carboxamide |
| Molecular Weight: | 307.35 |
| Molecular Formula: | C19 H17 N O3 |
| Smiles: | [H]N(C(C1=CC(c2ccc(C)cc2O1)=O)=O)c1cc(C)ccc1C |
| Stereo: | ACHIRAL |
| logP: | 3.9598 |
| logD: | 3.9597 |
| logSw: | -3.9485 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 44.45 |
| InChI Key: | AISIVZRTXUEHIH-UHFFFAOYSA-N |