N-(2,4-dimethoxyphenyl)-6-ethyl-4-oxo-4H-1-benzopyran-2-carboxamide
Chemical Structure Depiction of
N-(2,4-dimethoxyphenyl)-6-ethyl-4-oxo-4H-1-benzopyran-2-carboxamide
N-(2,4-dimethoxyphenyl)-6-ethyl-4-oxo-4H-1-benzopyran-2-carboxamide
Compound characteristics
| Compound ID: | D103-0457 |
| Compound Name: | N-(2,4-dimethoxyphenyl)-6-ethyl-4-oxo-4H-1-benzopyran-2-carboxamide |
| Molecular Weight: | 353.37 |
| Molecular Formula: | C20 H19 N O5 |
| Smiles: | [H]N(C(C1=CC(c2cc(CC)ccc2O1)=O)=O)c1ccc(cc1OC)OC |
| Stereo: | ACHIRAL |
| logP: | 4.0703 |
| logD: | 4.0619 |
| logSw: | -4.2494 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 59.624 |
| InChI Key: | AXULSBXYWSUJLI-UHFFFAOYSA-N |