N-(6-chloro-1,3-benzothiazol-2-yl)-6,7-dimethyl-4-oxo-4H-1-benzopyran-2-carboxamide
Chemical Structure Depiction of
N-(6-chloro-1,3-benzothiazol-2-yl)-6,7-dimethyl-4-oxo-4H-1-benzopyran-2-carboxamide
N-(6-chloro-1,3-benzothiazol-2-yl)-6,7-dimethyl-4-oxo-4H-1-benzopyran-2-carboxamide
Compound characteristics
| Compound ID: | D103-2016 |
| Compound Name: | N-(6-chloro-1,3-benzothiazol-2-yl)-6,7-dimethyl-4-oxo-4H-1-benzopyran-2-carboxamide |
| Molecular Weight: | 384.84 |
| Molecular Formula: | C19 H13 Cl N2 O3 S |
| Smiles: | Cc1cc2C(C=C(C(Nc3nc4ccc(cc4s3)[Cl])=O)Oc2cc1C)=O |
| Stereo: | ACHIRAL |
| logP: | 5.791 |
| logD: | 5.7612 |
| logSw: | -5.9232 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 54.909 |
| InChI Key: | OWSZDQPNDUYOQJ-UHFFFAOYSA-N |