4-oxo-N-(3-{[(oxolan-2-yl)methyl]carbamoyl}-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-4H-1-benzopyran-2-carboxamide
Chemical Structure Depiction of
4-oxo-N-(3-{[(oxolan-2-yl)methyl]carbamoyl}-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-4H-1-benzopyran-2-carboxamide
4-oxo-N-(3-{[(oxolan-2-yl)methyl]carbamoyl}-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-4H-1-benzopyran-2-carboxamide
Compound characteristics
| Compound ID: | D103-2306 |
| Compound Name: | 4-oxo-N-(3-{[(oxolan-2-yl)methyl]carbamoyl}-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-4H-1-benzopyran-2-carboxamide |
| Molecular Weight: | 438.5 |
| Molecular Formula: | C23 H22 N2 O5 S |
| Smiles: | [H]N(C(C1=CC(c2ccccc2O1)=O)=O)c1c(C(NCC2CCCO2)=O)c2CCCc2s1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.7906 |
| logD: | 0.3346 |
| logSw: | -3.7493 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 78.297 |
| InChI Key: | YJOYBDUAIRQMID-CYBMUJFWSA-N |