N-[(4-chlorophenyl)methyl]-N-[(furan-2-yl)methyl]-4-oxo-4H-1-benzopyran-2-carboxamide
Chemical Structure Depiction of
N-[(4-chlorophenyl)methyl]-N-[(furan-2-yl)methyl]-4-oxo-4H-1-benzopyran-2-carboxamide
N-[(4-chlorophenyl)methyl]-N-[(furan-2-yl)methyl]-4-oxo-4H-1-benzopyran-2-carboxamide
Compound characteristics
| Compound ID: | D103-2365 |
| Compound Name: | N-[(4-chlorophenyl)methyl]-N-[(furan-2-yl)methyl]-4-oxo-4H-1-benzopyran-2-carboxamide |
| Molecular Weight: | 393.83 |
| Molecular Formula: | C22 H16 Cl N O4 |
| Smiles: | C(c1ccc(cc1)[Cl])N(Cc1ccco1)C(C1=CC(c2ccccc2O1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.4487 |
| logD: | 4.4487 |
| logSw: | -4.9427 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 45.745 |
| InChI Key: | HNRFISSDIAUUGI-UHFFFAOYSA-N |