2-(4-chloro-3,5-dimethylphenoxy)-N-(3-phenyl-1,2-oxazol-5-yl)acetamide
Chemical Structure Depiction of
2-(4-chloro-3,5-dimethylphenoxy)-N-(3-phenyl-1,2-oxazol-5-yl)acetamide
2-(4-chloro-3,5-dimethylphenoxy)-N-(3-phenyl-1,2-oxazol-5-yl)acetamide
Compound characteristics
| Compound ID: | D107-0254 |
| Compound Name: | 2-(4-chloro-3,5-dimethylphenoxy)-N-(3-phenyl-1,2-oxazol-5-yl)acetamide |
| Molecular Weight: | 356.81 |
| Molecular Formula: | C19 H17 Cl N2 O3 |
| Smiles: | Cc1cc(cc(C)c1[Cl])OCC(Nc1cc(c2ccccc2)no1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.2507 |
| logD: | 5.2505 |
| logSw: | -5.8811 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 52.896 |
| InChI Key: | LZGIRQXESUNRCT-UHFFFAOYSA-N |