3-chloro-N-(3-phenyl-1,2-oxazol-5-yl)benzamide
Chemical Structure Depiction of
3-chloro-N-(3-phenyl-1,2-oxazol-5-yl)benzamide
3-chloro-N-(3-phenyl-1,2-oxazol-5-yl)benzamide
Compound characteristics
| Compound ID: | D107-0268 |
| Compound Name: | 3-chloro-N-(3-phenyl-1,2-oxazol-5-yl)benzamide |
| Molecular Weight: | 298.73 |
| Molecular Formula: | C16 H11 Cl N2 O2 |
| Smiles: | c1ccc(cc1)c1cc(NC(c2cccc(c2)[Cl])=O)on1 |
| Stereo: | ACHIRAL |
| logP: | 4.3031 |
| logD: | 4.2629 |
| logSw: | -4.6674 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 45.611 |
| InChI Key: | LDUVZJUUZMPYQX-UHFFFAOYSA-N |