N-[3-(4-methylphenyl)-1,2-oxazol-5-yl]-2-(pentafluorophenoxy)acetamide
Chemical Structure Depiction of
N-[3-(4-methylphenyl)-1,2-oxazol-5-yl]-2-(pentafluorophenoxy)acetamide
N-[3-(4-methylphenyl)-1,2-oxazol-5-yl]-2-(pentafluorophenoxy)acetamide
Compound characteristics
| Compound ID: | D107-0376 |
| Compound Name: | N-[3-(4-methylphenyl)-1,2-oxazol-5-yl]-2-(pentafluorophenoxy)acetamide |
| Molecular Weight: | 398.29 |
| Molecular Formula: | C18 H11 F5 N2 O3 |
| Smiles: | Cc1ccc(cc1)c1cc(NC(COc2c(c(c(c(c2F)F)F)F)F)=O)on1 |
| Stereo: | ACHIRAL |
| logP: | 4.9725 |
| logD: | 4.9723 |
| logSw: | -4.6596 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 53.069 |
| InChI Key: | ZWRUEPSWRZMXHA-UHFFFAOYSA-N |