N-[3-(4-fluorophenyl)-1,2-oxazol-5-yl]-4-[(prop-2-en-1-yl)oxy]benzamide
Chemical Structure Depiction of
N-[3-(4-fluorophenyl)-1,2-oxazol-5-yl]-4-[(prop-2-en-1-yl)oxy]benzamide
N-[3-(4-fluorophenyl)-1,2-oxazol-5-yl]-4-[(prop-2-en-1-yl)oxy]benzamide
Compound characteristics
| Compound ID: | D107-0520 |
| Compound Name: | N-[3-(4-fluorophenyl)-1,2-oxazol-5-yl]-4-[(prop-2-en-1-yl)oxy]benzamide |
| Molecular Weight: | 338.34 |
| Molecular Formula: | C19 H15 F N2 O3 |
| Smiles: | C=CCOc1ccc(cc1)C(Nc1cc(c2ccc(cc2)F)no1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.3076 |
| logD: | 4.3049 |
| logSw: | -4.3948 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 53.028 |
| InChI Key: | MSVDERRRLWBUJG-UHFFFAOYSA-N |