N-[4-(3,4-diethoxyphenyl)-1,2,5-oxadiazol-3-yl]-4-fluorobenzamide
Chemical Structure Depiction of
N-[4-(3,4-diethoxyphenyl)-1,2,5-oxadiazol-3-yl]-4-fluorobenzamide
N-[4-(3,4-diethoxyphenyl)-1,2,5-oxadiazol-3-yl]-4-fluorobenzamide
Compound characteristics
| Compound ID: | D109-0107 |
| Compound Name: | N-[4-(3,4-diethoxyphenyl)-1,2,5-oxadiazol-3-yl]-4-fluorobenzamide |
| Molecular Weight: | 371.37 |
| Molecular Formula: | C19 H18 F N3 O4 |
| Smiles: | CCOc1ccc(cc1OCC)c1c(NC(c2ccc(cc2)F)=O)non1 |
| Stereo: | ACHIRAL |
| logP: | 3.8172 |
| logD: | 3.5047 |
| logSw: | -3.9849 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 74.507 |
| InChI Key: | CJZSDJBNWDNKAA-UHFFFAOYSA-N |