N-[4-(3,4-diethoxyphenyl)-1,2,5-oxadiazol-3-yl]-2-(2-fluorophenoxy)butanamide
Chemical Structure Depiction of
N-[4-(3,4-diethoxyphenyl)-1,2,5-oxadiazol-3-yl]-2-(2-fluorophenoxy)butanamide
N-[4-(3,4-diethoxyphenyl)-1,2,5-oxadiazol-3-yl]-2-(2-fluorophenoxy)butanamide
Compound characteristics
| Compound ID: | D109-0175 |
| Compound Name: | N-[4-(3,4-diethoxyphenyl)-1,2,5-oxadiazol-3-yl]-2-(2-fluorophenoxy)butanamide |
| Molecular Weight: | 429.45 |
| Molecular Formula: | C22 H24 F N3 O5 |
| Smiles: | CCC(C(Nc1c(c2ccc(c(c2)OCC)OCC)non1)=O)Oc1ccccc1F |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.9402 |
| logD: | 4.9351 |
| logSw: | -4.5519 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 81.265 |
| InChI Key: | RAGHFEOQLULXLG-INIZCTEOSA-N |