3-{[5-(4-chlorophenyl)-2H-tetrazol-2-yl]methyl}-5-[(4-fluorophenyl)methyl]-3H-[1,2,3]triazolo[4,5-d]pyrimidin-7-ol
Chemical Structure Depiction of
3-{[5-(4-chlorophenyl)-2H-tetrazol-2-yl]methyl}-5-[(4-fluorophenyl)methyl]-3H-[1,2,3]triazolo[4,5-d]pyrimidin-7-ol
3-{[5-(4-chlorophenyl)-2H-tetrazol-2-yl]methyl}-5-[(4-fluorophenyl)methyl]-3H-[1,2,3]triazolo[4,5-d]pyrimidin-7-ol
Compound characteristics
| Compound ID: | D112-0016 |
| Compound Name: | 3-{[5-(4-chlorophenyl)-2H-tetrazol-2-yl]methyl}-5-[(4-fluorophenyl)methyl]-3H-[1,2,3]triazolo[4,5-d]pyrimidin-7-ol |
| Molecular Weight: | 437.82 |
| Molecular Formula: | C19 H13 Cl F N9 O |
| Smiles: | C(c1ccc(cc1)F)c1nc(c2c(n1)n(Cn1nc(c3ccc(cc3)[Cl])nn1)nn2)O |
| Stereo: | ACHIRAL |
| logP: | 3.0968 |
| logD: | 1.3018 |
| logSw: | -3.3792 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 103.341 |
| InChI Key: | ZFKFINKMBKAKHE-UHFFFAOYSA-N |