5-[(2,4-dichlorophenyl)methyl]-N-(3-ethylphenyl)-3-methyl-3H-[1,2,3]triazolo[4,5-d]pyrimidin-7-amine
Chemical Structure Depiction of
5-[(2,4-dichlorophenyl)methyl]-N-(3-ethylphenyl)-3-methyl-3H-[1,2,3]triazolo[4,5-d]pyrimidin-7-amine
5-[(2,4-dichlorophenyl)methyl]-N-(3-ethylphenyl)-3-methyl-3H-[1,2,3]triazolo[4,5-d]pyrimidin-7-amine
Compound characteristics
| Compound ID: | D112-0128 |
| Compound Name: | 5-[(2,4-dichlorophenyl)methyl]-N-(3-ethylphenyl)-3-methyl-3H-[1,2,3]triazolo[4,5-d]pyrimidin-7-amine |
| Molecular Weight: | 413.31 |
| Molecular Formula: | C20 H18 Cl2 N6 |
| Smiles: | CCc1cccc(c1)Nc1c2c(nc(Cc3ccc(cc3[Cl])[Cl])n1)n(C)nn2 |
| Stereo: | ACHIRAL |
| logP: | 5.6738 |
| logD: | 5.6734 |
| logSw: | -6.0767 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 56.694 |
| InChI Key: | CZTMHAQJZQJEFO-UHFFFAOYSA-N |