1-(2-hydroxyphenyl)-3-(1-methyl-1H-indol-3-yl)pyrrolidine-2,5-dione
Chemical Structure Depiction of
1-(2-hydroxyphenyl)-3-(1-methyl-1H-indol-3-yl)pyrrolidine-2,5-dione
1-(2-hydroxyphenyl)-3-(1-methyl-1H-indol-3-yl)pyrrolidine-2,5-dione
Compound characteristics
| Compound ID: | D115-0067 |
| Compound Name: | 1-(2-hydroxyphenyl)-3-(1-methyl-1H-indol-3-yl)pyrrolidine-2,5-dione |
| Molecular Weight: | 320.35 |
| Molecular Formula: | C19 H16 N2 O3 |
| Smiles: | Cn1cc(C2CC(N(C2=O)c2ccccc2O)=O)c2ccccc12 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.2195 |
| logD: | 2.2178 |
| logSw: | -2.4764 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.964 |
| InChI Key: | FDBJQBVXVGNJGD-ZDUSSCGKSA-N |