3-(1-ethyl-1H-indol-3-yl)-1-phenylpyrrolidine-2,5-dione
Chemical Structure Depiction of
3-(1-ethyl-1H-indol-3-yl)-1-phenylpyrrolidine-2,5-dione
3-(1-ethyl-1H-indol-3-yl)-1-phenylpyrrolidine-2,5-dione
Compound characteristics
| Compound ID: | D115-0081 |
| Compound Name: | 3-(1-ethyl-1H-indol-3-yl)-1-phenylpyrrolidine-2,5-dione |
| Molecular Weight: | 318.37 |
| Molecular Formula: | C20 H18 N2 O2 |
| Smiles: | CCn1cc(C2CC(N(C2=O)c2ccccc2)=O)c2ccccc12 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.4504 |
| logD: | 2.4504 |
| logSw: | -2.5894 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 30.886 |
| InChI Key: | RJFUMUUJPFDMOX-INIZCTEOSA-N |