3-(1-ethyl-1H-indol-3-yl)-1-(4-methoxyphenyl)pyrrolidine-2,5-dione
					Chemical Structure Depiction of
3-(1-ethyl-1H-indol-3-yl)-1-(4-methoxyphenyl)pyrrolidine-2,5-dione
			3-(1-ethyl-1H-indol-3-yl)-1-(4-methoxyphenyl)pyrrolidine-2,5-dione
Compound characteristics
| Compound ID: | D115-0085 | 
| Compound Name: | 3-(1-ethyl-1H-indol-3-yl)-1-(4-methoxyphenyl)pyrrolidine-2,5-dione | 
| Molecular Weight: | 348.4 | 
| Molecular Formula: | C21 H20 N2 O3 | 
| Smiles: | CCn1cc(C2CC(N(C2=O)c2ccc(cc2)OC)=O)c2ccccc12 | 
| Stereo: | RACEMIC MIXTURE | 
| logP: | 2.5544 | 
| logD: | 2.5544 | 
| logSw: | -2.6345 | 
| Hydrogen bond acceptors count: | 5 | 
| Polar surface area: | 38.43 | 
| InChI Key: | ODLNOMCXHPXZRM-KRWDZBQOSA-N | 
 
				 
				