1-(benzenesulfonyl)-3-(furan-2-yl)-N-[(thiophen-2-yl)methyl]-1H-1,2,4-triazol-5-amine
Chemical Structure Depiction of
1-(benzenesulfonyl)-3-(furan-2-yl)-N-[(thiophen-2-yl)methyl]-1H-1,2,4-triazol-5-amine
1-(benzenesulfonyl)-3-(furan-2-yl)-N-[(thiophen-2-yl)methyl]-1H-1,2,4-triazol-5-amine
Compound characteristics
| Compound ID: | D116-0023 |
| Compound Name: | 1-(benzenesulfonyl)-3-(furan-2-yl)-N-[(thiophen-2-yl)methyl]-1H-1,2,4-triazol-5-amine |
| Molecular Weight: | 386.45 |
| Molecular Formula: | C17 H14 N4 O3 S2 |
| Smiles: | C(c1cccs1)Nc1nc(c2ccco2)nn1S(c1ccccc1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.1271 |
| logD: | 3.1271 |
| logSw: | -3.3569 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 71.83 |
| InChI Key: | ONQXCAWXMXMLCS-UHFFFAOYSA-N |