N-[3-hydroxy-3-(4-propoxyphenyl)propyl]leucine
Chemical Structure Depiction of
N-[3-hydroxy-3-(4-propoxyphenyl)propyl]leucine
N-[3-hydroxy-3-(4-propoxyphenyl)propyl]leucine
Compound characteristics
| Compound ID: | D117-0010 |
| Compound Name: | N-[3-hydroxy-3-(4-propoxyphenyl)propyl]leucine |
| Molecular Weight: | 323.43 |
| Molecular Formula: | C18 H29 N O4 |
| Smiles: | CCCOc1ccc(cc1)C(CCNC(CC(C)C)C(O)=O)O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 1.9996 |
| logD: | 1.9996 |
| logSw: | -2.451 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 63.516 |
| InChI Key: | CFYWYMRLJHXHEG-UHFFFAOYSA-N |