3-(4-bromophenyl)-4,8,9-trimethyl-7H-furo[2,3-f][1]benzopyran-7-one
Chemical Structure Depiction of
3-(4-bromophenyl)-4,8,9-trimethyl-7H-furo[2,3-f][1]benzopyran-7-one
3-(4-bromophenyl)-4,8,9-trimethyl-7H-furo[2,3-f][1]benzopyran-7-one
Compound characteristics
| Compound ID: | D129-0069 |
| Compound Name: | 3-(4-bromophenyl)-4,8,9-trimethyl-7H-furo[2,3-f][1]benzopyran-7-one |
| Molecular Weight: | 383.24 |
| Molecular Formula: | C20 H15 Br O3 |
| Smiles: | CC1=C(C)c2c(cc(C)c3c(coc23)c2ccc(cc2)[Br])OC1=O |
| Stereo: | ACHIRAL |
| logP: | 5.8239 |
| logD: | 5.8239 |
| logSw: | -5.9511 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 30.6812 |
| InChI Key: | RWLFYSARMJPJMR-UHFFFAOYSA-N |