3-[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]pyridine
Chemical Structure Depiction of
3-[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]pyridine
3-[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]pyridine
Compound characteristics
| Compound ID: | D134-0062 |
| Compound Name: | 3-[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]pyridine |
| Molecular Weight: | 253.26 |
| Molecular Formula: | C14 H11 N3 O2 |
| Smiles: | COc1ccccc1c1nc(c2cccnc2)on1 |
| Stereo: | ACHIRAL |
| logP: | 2.3601 |
| logD: | 2.3559 |
| logSw: | -2.2804 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 48.792 |
| InChI Key: | ATGWJMHVOAQPDO-UHFFFAOYSA-N |