3-(3,4-diethoxyphenyl)-5-(thiophen-2-yl)-1,2,4-oxadiazole
Chemical Structure Depiction of
3-(3,4-diethoxyphenyl)-5-(thiophen-2-yl)-1,2,4-oxadiazole
3-(3,4-diethoxyphenyl)-5-(thiophen-2-yl)-1,2,4-oxadiazole
Compound characteristics
| Compound ID: | D134-0134 |
| Compound Name: | 3-(3,4-diethoxyphenyl)-5-(thiophen-2-yl)-1,2,4-oxadiazole |
| Molecular Weight: | 316.38 |
| Molecular Formula: | C16 H16 N2 O3 S |
| Smiles: | CCOc1ccc(cc1OCC)c1nc(c2cccs2)on1 |
| Stereo: | ACHIRAL |
| logP: | 4.1076 |
| logD: | 4.1076 |
| logSw: | -4.2922 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 47.083 |
| InChI Key: | CNLNVKCXPPBBJX-UHFFFAOYSA-N |